About 3-(4-ethylphenyl)azepane
3-(4-ethylphenyl)azepane (PubChem CID 83819662) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-(4-ethylphenyl)azepane.
Molecular Properties
| Compound Name | 3-(4-ethylphenyl)azepane |
| PubChem CID | 83819662 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-(4-ethylphenyl)azepane |
| SMILES | CCc1ccc(C2CCCCNC2)cc1 |
| InChI | InChI=1S/C14H21N/c1-2-12-6-8-13(9-7-12)14-5-3-4-10-15-11-14/h6-9,14-15H,2-5,10-11H2,1H3 |
| InChIKey | RBVGCLLILHPJMA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-ethylphenyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethylphenyl)azepane?
The IUPAC name of 3-(4-ethylphenyl)azepane (CID 83819662) is 3-(4-ethylphenyl)azepane.
What is the SMILES notation for 3-(4-ethylphenyl)azepane?
The canonical SMILES for 3-(4-ethylphenyl)azepane is CCc1ccc(C2CCCCNC2)cc1.
What is the InChIKey of 3-(4-ethylphenyl)azepane?
The InChIKey is RBVGCLLILHPJMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-2-12-6-8-13(9-7-12)14-5-3-4-10-15-11-14/h6-9,14-15H,2-5,10-11H2,1H3.
What are the key properties of 3-(4-ethylphenyl)azepane?
3-(4-ethylphenyl)azepane has a molecular weight of 203.33 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethylphenyl)azepane is sourced from PubChem (CID 83819662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).