C14H19NO2S — CID 129385009
(2S,5R)-3-cyclohexyl-5-phenyloxathiazolidine 2-oxide (PubChem CID 129385009) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is (2S,5R)-3-cyclohexyl-5-phenyloxathiazolidine 2-oxide.
| Compound Name | (2S,5R)-3-cyclohexyl-5-phenyloxathiazolidine 2-oxide |
|---|---|
| PubChem CID | 129385009 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (2S,5R)-3-cyclohexyl-5-phenyloxathiazolidine 2-oxide |
| SMILES | O=[S@]1O[C@H](c2ccccc2)CN1C1CCCCC1 |
| InChI | InChI=1S/C14H19NO2S/c16-18-15(13-9-5-2-6-10-13)11-14(17-18)12-7-3-1-4-8-12/h1,3-4,7-8,13-14H,2,5-6,9-11H2/t14-,18-/m0/s1 |
| InChIKey | MGHPESGPQYBMSU-KSSFIOAISA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |