C15H9BrF2O2 — CID 114673069
7-bromo-2-(2,4-difluorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 114673069) has the molecular formula C15H9BrF2O2 and a molecular weight of 339.14 g/mol. Its IUPAC name is 7-bromo-2-(2,4-difluorophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 7-bromo-2-(2,4-difluorophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114673069 |
| Molecular Formula | C15H9BrF2O2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 7-bromo-2-(2,4-difluorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccc(F)cc2F)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H9BrF2O2/c16-8-1-3-11-13(19)7-15(20-14(11)5-8)10-4-2-9(17)6-12(10)18/h1-6,15H,7H2 |
| InChIKey | SDJHLIGNDJHHKF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |