C9H6BrFO2 — CID 172550133
2-bromo-7-fluoro-2,3-dihydrochromen-4-one (PubChem CID 172550133) has the molecular formula C9H6BrFO2 and a molecular weight of 245.05 g/mol. Its IUPAC name is 2-bromo-7-fluoro-2,3-dihydrochromen-4-one.
| Compound Name | 2-bromo-7-fluoro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 172550133 |
| Molecular Formula | C9H6BrFO2 |
| Molecular Weight | 245.05 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 2-bromo-7-fluoro-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(Br)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C9H6BrFO2/c10-9-4-7(12)6-2-1-5(11)3-8(6)13-9/h1-3,9H,4H2 |
| InChIKey | FIFKCOJCCPKSLA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.05 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|