C12H11FO2 — CID 114674627
2-cyclopropyl-7-fluoro-2,3-dihydrochromen-4-one (PubChem CID 114674627) has the molecular formula C12H11FO2 and a molecular weight of 206.22 g/mol. Its IUPAC name is 2-cyclopropyl-7-fluoro-2,3-dihydrochromen-4-one.
| Compound Name | 2-cyclopropyl-7-fluoro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114674627 |
| Molecular Formula | C12H11FO2 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-cyclopropyl-7-fluoro-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(C2CC2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C12H11FO2/c13-8-3-4-9-10(14)6-11(7-1-2-7)15-12(9)5-8/h3-5,7,11H,1-2,6H2 |
| InChIKey | IGAMHPIDKLNKTG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |