C13H8BrFO2S — CID 114674866
2-(3-bromothiophen-2-yl)-7-fluoro-2,3-dihydrochromen-4-one (PubChem CID 114674866) has the molecular formula C13H8BrFO2S and a molecular weight of 327.17 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-7-fluoro-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3-bromothiophen-2-yl)-7-fluoro-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114674866 |
| Molecular Formula | C13H8BrFO2S |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-7-fluoro-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2sccc2Br)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H8BrFO2S/c14-9-3-4-18-13(9)12-6-10(16)8-2-1-7(15)5-11(8)17-12/h1-5,12H,6H2 |
| InChIKey | SBDLPGOHFPZKEM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |