C16H13FO2 — CID 91411003
2-(2-fluoro-3-methylphenyl)-2,3-dihydrochromen-4-one (PubChem CID 91411003) has the molecular formula C16H13FO2 and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(2-fluoro-3-methylphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(2-fluoro-3-methylphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91411003 |
| Molecular Formula | C16H13FO2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-(2-fluoro-3-methylphenyl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1cccc(C2CC(=O)c3ccccc3O2)c1F |
| InChI | InChI=1S/C16H13FO2/c1-10-5-4-7-12(16(10)17)15-9-13(18)11-6-2-3-8-14(11)19-15/h2-8,15H,9H2,1H3 |
| InChIKey | ZHEPCASGWMWRFK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |