C15H14O2S — CID 114671481
2-(2,5-dimethylthiophen-3-yl)-2,3-dihydrochromen-4-one (PubChem CID 114671481) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 2-(2,5-dimethylthiophen-3-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(2,5-dimethylthiophen-3-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114671481 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(2,5-dimethylthiophen-3-yl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1cc(C2CC(=O)c3ccccc3O2)c(C)s1 |
| InChI | InChI=1S/C15H14O2S/c1-9-7-12(10(2)18-9)15-8-13(16)11-5-3-4-6-14(11)17-15/h3-7,15H,8H2,1-2H3 |
| InChIKey | ZHNILNVPEPOHBC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |