C26H39F5O2 — CID 159053657
1-(difluoromethoxy)-2-fluoro-4-(4-fluorocyclohexyl)benzene;1-(2-fluoroethyl)-4-pentoxycyclohexane (PubChem CID 159053657) has the molecular formula C26H39F5O2 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-(difluoromethoxy)-2-fluoro-4-(4-fluorocyclohexyl)benzene;1-(2-fluoroethyl)-4-pentoxycyclohexane.
| Compound Name | 1-(difluoromethoxy)-2-fluoro-4-(4-fluorocyclohexyl)benzene;1-(2-fluoroethyl)-4-pentoxycyclohexane |
|---|---|
| PubChem CID | 159053657 |
| Molecular Formula | C26H39F5O2 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 1-(difluoromethoxy)-2-fluoro-4-(4-fluorocyclohexyl)benzene;1-(2-fluoroethyl)-4-pentoxycyclohexane |
| SMILES | CCCCCOC1CCC(CCF)CC1.Fc1cc(C2CCC(F)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C13H14F4O.C13H25FO/c14-10-4-1-8(2-5-10)9-3-6-12(11(15)7-9)18-13(16)17;1-2-3-4-11-15-13-7-5-12(6-8-13)9-10-14/h3,6-8,10,13H,1-2,4-5H2;12-13H,2-11H2,1H3 |
| InChIKey | JXOZOQYUPZBTHS-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|