C21H25F3Si — CID 123492543
ethyl-[4-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclohexyl]silane (PubChem CID 123492543) has the molecular formula C21H25F3Si and a molecular weight of 362.51 g/mol. Its IUPAC name is ethyl-[4-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclohexyl]silane.
| Compound Name | ethyl-[4-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclohexyl]silane |
|---|---|
| PubChem CID | 123492543 |
| Molecular Formula | C21H25F3Si |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | ethyl-[4-[4-[4-(trifluoromethyl)phenyl]phenyl]cyclohexyl]silane |
| SMILES | CC[SiH2]C1CCC(c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H25F3Si/c1-2-25-20-13-9-18(10-14-20)16-5-3-15(4-6-16)17-7-11-19(12-8-17)21(22,23)24/h3-8,11-12,18,20H,2,9-10,13-14,25H2,1H3 |
| InChIKey | DOXHRKRFDRRDBN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|