C54H81NO9 — CID 163961209
[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[8-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]octoxy]benzoate (PubChem CID 163961209) has the molecular formula C54H81NO9 and a molecular weight of 888.24 g/mol. Its IUPAC name is [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[8-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]octoxy]benzoate.
| Compound Name | [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[8-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]octoxy]benzoate |
|---|---|
| PubChem CID | 163961209 |
| Molecular Formula | C54H81NO9 |
| Molecular Weight | 888.24 g/mol |
| Exact Mass | 887.59 |
| IUPAC Name | [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[8-[3-[5-(ethoxycarbonylamino)-1,3,3-trimethylcyclohexyl]propanoyloxy]octoxy]benzoate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)c4ccc(OCCCCCCCCOC(=O)CCC5(C)CC(NC(=O)OCC)CC(C)(C)C5)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C54H81NO9/c1-6-8-13-16-40-17-19-41(20-18-40)42-21-23-43(24-22-42)50(57)63-47-29-31-48(32-30-47)64-51(58)44-25-27-46(28-26-44)61-35-14-11-9-10-12-15-36-62-49(56)33-34-54(5)38-45(37-53(3,4)39-54)55-52(59)60-7-2/h25-32,40-43,45H,6-24,33-39H2,1-5H3,(H,55,59) |
| InChIKey | IGFBEECXUKYFOM-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.24 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|