C44H64O10 — CID 157457014
(4-acetyloxyphenyl) 4-hexoxybenzoate;6-(4-methylcyclohexyl)oxyhexyl 6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 157457014) has the molecular formula C44H64O10 and a molecular weight of 752.99 g/mol. Its IUPAC name is (4-acetyloxyphenyl) 4-hexoxybenzoate;6-(4-methylcyclohexyl)oxyhexyl 6-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | (4-acetyloxyphenyl) 4-hexoxybenzoate;6-(4-methylcyclohexyl)oxyhexyl 6-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 157457014 |
| Molecular Formula | C44H64O10 |
| Molecular Weight | 752.99 g/mol |
| Exact Mass | 752.45 |
| IUPAC Name | (4-acetyloxyphenyl) 4-hexoxybenzoate;6-(4-methylcyclohexyl)oxyhexyl 6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(=O)OCCCCCCOC1CCC(C)CC1.CCCCCCOc1ccc(C(=O)Oc2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C23H40O5.C21H24O5/c1-19(2)23(25)28-18-10-6-7-11-22(24)27-17-9-5-4-8-16-26-21-14-12-20(3)13-15-21;1-3-4-5-6-15-24-18-9-7-17(8-10-18)21(23)26-20-13-11-19(12-14-20)25-16(2)22/h20-21H,1,4-18H2,2-3H3;7-14H,3-6,15H2,1-2H3 |
| InChIKey | BTMCKBXDONTOHT-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.99 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|