C14H21BrIO2P — CID 171076676
6-(3-bromophenyl)-6-iodophosphanyloxy-2,2-dimethylhexan-1-ol (PubChem CID 171076676) has the molecular formula C14H21BrIO2P and a molecular weight of 459.10 g/mol. Its IUPAC name is 6-(3-bromophenyl)-6-iodophosphanyloxy-2,2-dimethylhexan-1-ol.
| Compound Name | 6-(3-bromophenyl)-6-iodophosphanyloxy-2,2-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 171076676 |
| Molecular Formula | C14H21BrIO2P |
| Molecular Weight | 459.10 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | 6-(3-bromophenyl)-6-iodophosphanyloxy-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCC(OPI)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H21BrIO2P/c1-14(2,10-17)8-4-7-13(18-19-16)11-5-3-6-12(15)9-11/h3,5-6,9,13,17,19H,4,7-8,10H2,1-2H3 |
| InChIKey | XNDVAXGQWLCPRU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.10 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|