C20H32IO4P — CID 171077674
ethyl 3-[3-(6-hydroxy-1-iodophosphanyloxy-5,5-dimethylhexyl)phenyl]-2-methylpropanoate (PubChem CID 171077674) has the molecular formula C20H32IO4P and a molecular weight of 494.35 g/mol. Its IUPAC name is ethyl 3-[3-(6-hydroxy-1-iodophosphanyloxy-5,5-dimethylhexyl)phenyl]-2-methylpropanoate.
| Compound Name | ethyl 3-[3-(6-hydroxy-1-iodophosphanyloxy-5,5-dimethylhexyl)phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 171077674 |
| Molecular Formula | C20H32IO4P |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | ethyl 3-[3-(6-hydroxy-1-iodophosphanyloxy-5,5-dimethylhexyl)phenyl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)Cc1cccc(C(CCCC(C)(C)CO)OPI)c1 |
| InChI | InChI=1S/C20H32IO4P/c1-5-24-19(23)15(2)12-16-8-6-9-17(13-16)18(25-26-21)10-7-11-20(3,4)14-22/h6,8-9,13,15,18,22,26H,5,7,10-12,14H2,1-4H3 |
| InChIKey | QZIRCYIPTUWVMY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|