C16H21NO5S — CID 87797194
6-[methyl(phenylmethoxycarbonyl)amino]-2-sulfanylcarbonylhexanoic acid (PubChem CID 87797194) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 6-[methyl(phenylmethoxycarbonyl)amino]-2-sulfanylcarbonylhexanoic acid.
| Compound Name | 6-[methyl(phenylmethoxycarbonyl)amino]-2-sulfanylcarbonylhexanoic acid |
|---|---|
| PubChem CID | 87797194 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-[methyl(phenylmethoxycarbonyl)amino]-2-sulfanylcarbonylhexanoic acid |
| SMILES | CN(CCCCC(C(=O)O)C(=O)S)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO5S/c1-17(10-6-5-9-13(14(18)19)15(20)23)16(21)22-11-12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11H2,1H3,(H,18,19)(H,20,23) |
| InChIKey | JIKPRSPZYSZORO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|