C27H45NO13P2 — CID 54461463
[1-[bis(2-ethylbutanoyloxymethoxy)phosphoryl]-1-hydroxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]phosphonic acid (PubChem CID 54461463) has the molecular formula C27H45NO13P2 and a molecular weight of 653.60 g/mol. Its IUPAC name is [1-[bis(2-ethylbutanoyloxymethoxy)phosphoryl]-1-hydroxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]phosphonic acid.
| Compound Name | [1-[bis(2-ethylbutanoyloxymethoxy)phosphoryl]-1-hydroxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]phosphonic acid |
|---|---|
| PubChem CID | 54461463 |
| Molecular Formula | C27H45NO13P2 |
| Molecular Weight | 653.60 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | [1-[bis(2-ethylbutanoyloxymethoxy)phosphoryl]-1-hydroxy-4-[methyl(phenylmethoxycarbonyl)amino]butyl]phosphonic acid |
| SMILES | CCC(CC)C(=O)OCOP(=O)(OCOC(=O)C(CC)CC)C(O)(CCCN(C)C(=O)OCc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C27H45NO13P2/c1-6-22(7-2)24(29)38-19-40-43(36,41-20-39-25(30)23(8-3)9-4)27(32,42(33,34)35)16-13-17-28(5)26(31)37-18-21-14-11-10-12-15-21/h10-12,14-15,22-23,32H,6-9,13,16-20H2,1-5H3,(H2,33,34,35) |
| InChIKey | XBXFYILTAJPJTR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 195.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|