C22H28NO6P — CID 67908234
(2-benzyl-3-methoxy-3-oxopropyl)-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]phosphinic acid (PubChem CID 67908234) has the molecular formula C22H28NO6P and a molecular weight of 433.44 g/mol. Its IUPAC name is (2-benzyl-3-methoxy-3-oxopropyl)-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]phosphinic acid.
| Compound Name | (2-benzyl-3-methoxy-3-oxopropyl)-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 67908234 |
| Molecular Formula | C22H28NO6P |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2-benzyl-3-methoxy-3-oxopropyl)-[2-[methyl(phenylmethoxycarbonyl)amino]ethyl]phosphinic acid |
| SMILES | COC(=O)C(Cc1ccccc1)CP(=O)(O)CCN(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H28NO6P/c1-23(22(25)29-16-19-11-7-4-8-12-19)13-14-30(26,27)17-20(21(24)28-2)15-18-9-5-3-6-10-18/h3-12,20H,13-17H2,1-2H3,(H,26,27) |
| InChIKey | NAJTXDDDUCBQHC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|