C24H37NO8 — CID 144616960
methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-(ethoxymethoxy)-2-methylphenyl]propanoate (PubChem CID 144616960) has the molecular formula C24H37NO8 and a molecular weight of 467.56 g/mol. Its IUPAC name is methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-(ethoxymethoxy)-2-methylphenyl]propanoate.
| Compound Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-(ethoxymethoxy)-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 144616960 |
| Molecular Formula | C24H37NO8 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | methyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[4-(ethoxymethoxy)-2-methylphenyl]propanoate |
| SMILES | CCOCOc1ccc(C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C24H37NO8/c1-10-30-15-31-18-12-11-17(16(2)13-18)14-19(20(26)29-9)25(21(27)32-23(3,4)5)22(28)33-24(6,7)8/h11-13,19H,10,14-15H2,1-9H3/t19-/m0/s1 |
| InChIKey | WXSULQTWRWSLIZ-IBGZPJMESA-N |
| XLogP | 4.62 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|