C20H29INO8- — CID 76670022
methyl 3-(4,5-dimethoxy-2-methyliodanuidylphenyl)-2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 76670022) has the molecular formula C20H29INO8- and a molecular weight of 538.36 g/mol. Its IUPAC name is methyl 3-(4,5-dimethoxy-2-methyliodanuidylphenyl)-2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | methyl 3-(4,5-dimethoxy-2-methyliodanuidylphenyl)-2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 76670022 |
| Molecular Formula | C20H29INO8- |
| Molecular Weight | 538.36 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | methyl 3-(4,5-dimethoxy-2-methyliodanuidylphenyl)-2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1cc(OC)c(OC)cc1[I-]C)N(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29INO8/c1-20(2,3)30-19(25)22(18(24)29-8)14(17(23)28-7)9-12-10-15(26-5)16(27-6)11-13(12)21-4/h10-11,14H,9H2,1-8H3/q-1 |
| InChIKey | CJOLZLKZXDNZEV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|