C14H21INO2- — CID 76670037
methyl 2-(dimethylamino)-3-(5-methyl-2-methyliodanuidylphenyl)propanoate (PubChem CID 76670037) has the molecular formula C14H21INO2- and a molecular weight of 362.23 g/mol. Its IUPAC name is methyl 2-(dimethylamino)-3-(5-methyl-2-methyliodanuidylphenyl)propanoate.
| Compound Name | methyl 2-(dimethylamino)-3-(5-methyl-2-methyliodanuidylphenyl)propanoate |
|---|---|
| PubChem CID | 76670037 |
| Molecular Formula | C14H21INO2- |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | methyl 2-(dimethylamino)-3-(5-methyl-2-methyliodanuidylphenyl)propanoate |
| SMILES | COC(=O)C(Cc1cc(C)ccc1[I-]C)N(C)C |
| InChI | InChI=1S/C14H21INO2/c1-10-6-7-12(15-2)11(8-10)9-13(16(3)4)14(17)18-5/h6-8,13H,9H2,1-5H3/q-1 |
| InChIKey | DHAMJFBXZRYGIW-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|