C27H36INO7 — CID 58036858
methyl 2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[5-methoxy-4-methyl-2-[methyl-(4-methylphenyl)-λ3-iodanyl]phenyl]propanoate (PubChem CID 58036858) has the molecular formula C27H36INO7 and a molecular weight of 613.49 g/mol. Its IUPAC name is methyl 2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[5-methoxy-4-methyl-2-[methyl-(4-methylphenyl)-λ3-iodanyl]phenyl]propanoate.
| Compound Name | methyl 2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[5-methoxy-4-methyl-2-[methyl-(4-methylphenyl)-λ3-iodanyl]phenyl]propanoate |
|---|---|
| PubChem CID | 58036858 |
| Molecular Formula | C27H36INO7 |
| Molecular Weight | 613.49 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | methyl 2-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[5-methoxy-4-methyl-2-[methyl-(4-methylphenyl)-λ3-iodanyl]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1cc(OC)c(C)cc1I(C)c1ccc(C)cc1)N(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H36INO7/c1-17-10-12-20(13-11-17)28(6)21-14-18(2)23(33-7)16-19(21)15-22(24(30)34-8)29(25(31)35-9)26(32)36-27(3,4)5/h10-14,16,22H,15H2,1-9H3 |
| InChIKey | KBRCDHVIZHCJFJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|