C30H39BN2O6 — CID 159116942
[(Z)-1-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-en-2-yl]boronic acid (PubChem CID 159116942) has the molecular formula C30H39BN2O6 and a molecular weight of 534.46 g/mol. Its IUPAC name is [(Z)-1-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-en-2-yl]boronic acid.
| Compound Name | [(Z)-1-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-en-2-yl]boronic acid |
|---|---|
| PubChem CID | 159116942 |
| Molecular Formula | C30H39BN2O6 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | [(Z)-1-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]-1-[1-(oxan-2-yl)indazol-5-yl]but-1-en-2-yl]boronic acid |
| SMILES | CC/C(B(O)O)=C(/c1ccc(OCCCC(=O)OC(C)(C)C)cc1)c1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C30H39BN2O6/c1-5-25(31(35)36)29(21-11-14-24(15-12-21)37-18-8-10-28(34)39-30(2,3)4)22-13-16-26-23(19-22)20-32-33(26)27-9-6-7-17-38-27/h11-16,19-20,27,35-36H,5-10,17-18H2,1-4H3/b29-25+ |
| InChIKey | PQLJGASFKPDDKO-XLVZBRSZSA-N |
| XLogP | 5.46 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|