C35H36ClFN2O3 — CID 129013595
tert-butyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate (PubChem CID 129013595) has the molecular formula C35H36ClFN2O3 and a molecular weight of 587.14 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 129013595 |
| Molecular Formula | C35H36ClFN2O3 |
| Molecular Weight | 587.14 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | tert-butyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)OC(C)(C)C)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C35H36ClFN2O3/c1-5-28(29-16-15-27(37)21-30(29)36)34(24-12-9-23(10-13-24)11-18-33(40)42-35(2,3)4)25-14-17-31-26(20-25)22-38-39(31)32-8-6-7-19-41-32/h9-18,20-22,32H,5-8,19H2,1-4H3/b18-11+,34-28+ |
| InChIKey | RSPRMTDWZFYEEU-GTVTXYFQSA-N |
| XLogP | 9.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.14 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|