C32H30N4O3 — CID 173019684
3-[2-[4-[1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 173019684) has the molecular formula C32H30N4O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 3-[2-[4-[1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[2-[4-[1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 173019684 |
| Molecular Formula | C32H30N4O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 3-[2-[4-[1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]ethenyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCC(=C(c1ccc(C=Cc2noc(=O)[nH]2)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C32H30N4O3/c1-2-27(23-8-4-3-5-9-23)31(24-14-11-22(12-15-24)13-18-29-34-32(37)39-35-29)25-16-17-28-26(20-25)21-33-36(28)30-10-6-7-19-38-30/h3-5,8-9,11-18,20-21,30H,2,6-7,10,19H2,1H3,(H,34,35,37) |
| InChIKey | QBBFVFYMZDTEJK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|