C31H29N3O — CID 66802201
(E)-3-[4-[(E)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enenitrile (PubChem CID 66802201) has the molecular formula C31H29N3O and a molecular weight of 459.59 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(E)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 66802201 |
| Molecular Formula | C31H29N3O |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (E)-3-[4-[(E)-1-[1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]phenyl]prop-2-enenitrile |
| SMILES | CC/C(=C(/c1ccc(/C=C/C#N)cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H29N3O/c1-2-28(24-10-4-3-5-11-24)31(25-15-13-23(14-16-25)9-8-19-32)26-17-18-29-27(21-26)22-33-34(29)30-12-6-7-20-35-30/h3-5,8-11,13-18,21-22,30H,2,6-7,12,20H2,1H3/b9-8+,31-28+ |
| InChIKey | FWPANRYQOUQUGP-LOGHLCTOSA-N |
| XLogP | 7.64 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|