C43H51ClFN3O3 — CID 140872925
(E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate;dicyclohexylazanium (PubChem CID 140872925) has the molecular formula C43H51ClFN3O3 and a molecular weight of 712.35 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate;dicyclohexylazanium.
| Compound Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate;dicyclohexylazanium |
|---|---|
| PubChem CID | 140872925 |
| Molecular Formula | C43H51ClFN3O3 |
| Molecular Weight | 712.35 g/mol |
| Exact Mass | 711.36 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]but-1-enyl]phenyl]prop-2-enoate;dicyclohexylazanium |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.CC/C(=C(/c1ccc(/C=C/C(=O)[O-])cc1)c1ccc2c(cnn2C2CCCCO2)c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C31H28ClFN2O3.C12H23N/c1-2-25(26-13-12-24(33)18-27(26)32)31(21-9-6-20(7-10-21)8-15-30(36)37)22-11-14-28-23(17-22)19-34-35(28)29-5-3-4-16-38-29;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h6-15,17-19,29H,2-5,16H2,1H3,(H,36,37);11-13H,1-10H2/b15-8+,31-25+; |
| InChIKey | KJDRFYPLQFPTKO-UIPNKLPCSA-N |
| XLogP | 8.88 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.35 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|