C35H38ClF2N3O2 — CID 134533781
5-[(Z)-1-(2-chloro-5-fluorophenyl)-2-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]but-1-enyl]-1-(oxan-2-yl)indazole (PubChem CID 134533781) has the molecular formula C35H38ClF2N3O2 and a molecular weight of 606.16 g/mol. Its IUPAC name is 5-[(Z)-1-(2-chloro-5-fluorophenyl)-2-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]but-1-enyl]-1-(oxan-2-yl)indazole.
| Compound Name | 5-[(Z)-1-(2-chloro-5-fluorophenyl)-2-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]but-1-enyl]-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 134533781 |
| Molecular Formula | C35H38ClF2N3O2 |
| Molecular Weight | 606.16 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 5-[(Z)-1-(2-chloro-5-fluorophenyl)-2-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]but-1-enyl]-1-(oxan-2-yl)indazole |
| SMILES | CC/C(=C(\c1ccc2c(cnn2C2CCCCO2)c1)c1cc(F)ccc1Cl)c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C35H38ClF2N3O2/c1-2-30(24-7-11-28(12-8-24)43-29-15-18-40(23-29)17-5-16-37)35(31-21-27(38)10-13-32(31)36)25-9-14-33-26(20-25)22-39-41(33)34-6-3-4-19-42-34/h7-14,20-22,29,34H,2-6,15-19,23H2,1H3/b35-30- |
| InChIKey | SZANBXYVSJSUFZ-GXVXDJONSA-N |
| XLogP | 8.71 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.16 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|