C35H31ClN2O2S — CID 123589088
tert-butyl 3-[4-[2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoate (PubChem CID 123589088) has the molecular formula C35H31ClN2O2S and a molecular weight of 579.17 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123589088 |
| Molecular Formula | C35H31ClN2O2S |
| Molecular Weight | 579.17 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | tert-butyl 3-[4-[2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccc(C(=C(c2ccc(C#N)cc2Cl)C2CCC2)c2ccc(-c3cncs3)cc2)cc1 |
| InChI | InChI=1S/C35H31ClN2O2S/c1-35(2,3)40-32(39)18-10-23-7-11-27(12-8-23)33(28-15-13-25(14-16-28)31-21-38-22-41-31)34(26-5-4-6-26)29-17-9-24(20-37)19-30(29)36/h7-19,21-22,26H,4-6H2,1-3H3 |
| InChIKey | NYSWPZFEXVAWGE-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.17 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|