C30H23ClFNO2S — CID 123139458
3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoic acid (PubChem CID 123139458) has the molecular formula C30H23ClFNO2S and a molecular weight of 516.04 g/mol. Its IUPAC name is 3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123139458 |
| Molecular Formula | C30H23ClFNO2S |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-[4-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(=C(c2ccc(F)cc2Cl)C2CCC2)c2ccc(-c3cncs3)cc2)cc1 |
| InChI | InChI=1S/C30H23ClFNO2S/c31-26-16-24(32)13-14-25(26)30(21-2-1-3-21)29(22-7-4-19(5-8-22)6-15-28(34)35)23-11-9-20(10-12-23)27-17-33-18-36-27/h4-18,21H,1-3H2,(H,34,35) |
| InChIKey | FMYNYRJYFUCNJA-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|