C29H24ClNO3S — CID 71746462
(E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-[2-chloro-4-(hydroxymethyl)phenyl]-2-cyclobutylethenyl]phenyl]prop-2-enoic acid (PubChem CID 71746462) has the molecular formula C29H24ClNO3S and a molecular weight of 502.04 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-[2-chloro-4-(hydroxymethyl)phenyl]-2-cyclobutylethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-[2-chloro-4-(hydroxymethyl)phenyl]-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71746462 |
| Molecular Formula | C29H24ClNO3S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-[2-chloro-4-(hydroxymethyl)phenyl]-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C(=C(\c2ccc(CO)cc2Cl)C2CCC2)c2ccc3scnc3c2)cc1 |
| InChI | InChI=1S/C29H24ClNO3S/c30-24-14-19(16-32)6-11-23(24)29(20-2-1-3-20)28(22-10-12-26-25(15-22)31-17-35-26)21-8-4-18(5-9-21)7-13-27(33)34/h4-15,17,20,32H,1-3,16H2,(H,33,34)/b13-7+,29-28+ |
| InChIKey | LZDWDJPSOSDVII-ZCERPGNRSA-N |
| XLogP | 7.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|