C29H22ClFO4 — CID 123656590
3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(7-hydroxy-1-benzofuran-3-yl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 123656590) has the molecular formula C29H22ClFO4 and a molecular weight of 488.94 g/mol. Its IUPAC name is 3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(7-hydroxy-1-benzofuran-3-yl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(7-hydroxy-1-benzofuran-3-yl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123656590 |
| Molecular Formula | C29H22ClFO4 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-[4-[2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(7-hydroxy-1-benzofuran-3-yl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(=C(c2ccc(F)cc2Cl)C2CCC2)c2coc3c(O)cccc23)cc1 |
| InChI | InChI=1S/C29H22ClFO4/c30-24-15-20(31)12-13-22(24)27(18-3-1-4-18)28(19-10-7-17(8-11-19)9-14-26(33)34)23-16-35-29-21(23)5-2-6-25(29)32/h2,5-16,18,32H,1,3-4H2,(H,33,34) |
| InChIKey | RCJSVRVDZGLLKH-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|