C27H21ClN2O2S — CID 66806658
(E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-(3-chloro-4-pyridinyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid (PubChem CID 66806658) has the molecular formula C27H21ClN2O2S and a molecular weight of 473.00 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-(3-chloro-4-pyridinyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-(3-chloro-4-pyridinyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66806658 |
| Molecular Formula | C27H21ClN2O2S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (E)-3-[4-[(E)-1-(1,3-benzothiazol-5-yl)-2-(3-chloro-4-pyridinyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C(=C(\c2ccncc2Cl)C2CCC2)c2ccc3scnc3c2)cc1 |
| InChI | InChI=1S/C27H21ClN2O2S/c28-22-15-29-13-12-21(22)27(18-2-1-3-18)26(20-9-10-24-23(14-20)30-16-33-24)19-7-4-17(5-8-19)6-11-25(31)32/h4-16,18H,1-3H2,(H,31,32)/b11-6+,27-26+ |
| InChIKey | AGWDFGGJNBHYAV-MDTFMHQWSA-N |
| XLogP | 7.20 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|