C28H22ClNO3S — CID 158621483
(E)-3-[4-[(E)-2-(3-chloro-2-pyridinyl)-2-cyclobutyl-1-(2-oxo-3H-1-benzothiophen-5-yl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 158621483) has the molecular formula C28H22ClNO3S and a molecular weight of 488.01 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(3-chloro-2-pyridinyl)-2-cyclobutyl-1-(2-oxo-3H-1-benzothiophen-5-yl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(3-chloro-2-pyridinyl)-2-cyclobutyl-1-(2-oxo-3H-1-benzothiophen-5-yl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 158621483 |
| Molecular Formula | C28H22ClNO3S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | (E)-3-[4-[(E)-2-(3-chloro-2-pyridinyl)-2-cyclobutyl-1-(2-oxo-3H-1-benzothiophen-5-yl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C(=C(\c2ncccc2Cl)C2CCC2)c2ccc3c(c2)CC(=O)S3)cc1 |
| InChI | InChI=1S/C28H22ClNO3S/c29-22-5-2-14-30-28(22)27(18-3-1-4-18)26(19-9-6-17(7-10-19)8-13-24(31)32)20-11-12-23-21(15-20)16-25(33)34-23/h2,5-15,18H,1,3-4,16H2,(H,31,32)/b13-8+,27-26+ |
| InChIKey | HYBAFUVJVZRSDX-MPADYNMASA-N |
| XLogP | 6.77 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|