C29H22ClF3N2O3 — CID 123553446
3-[4-[2-[2-chloro-4-(trifluoromethoxy)phenyl]-2-cyclobutyl-1-imidazo[1,2-a]pyridin-6-ylethenyl]phenyl]prop-2-enoic acid (PubChem CID 123553446) has the molecular formula C29H22ClF3N2O3 and a molecular weight of 538.95 g/mol. Its IUPAC name is 3-[4-[2-[2-chloro-4-(trifluoromethoxy)phenyl]-2-cyclobutyl-1-imidazo[1,2-a]pyridin-6-ylethenyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-[2-chloro-4-(trifluoromethoxy)phenyl]-2-cyclobutyl-1-imidazo[1,2-a]pyridin-6-ylethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123553446 |
| Molecular Formula | C29H22ClF3N2O3 |
| Molecular Weight | 538.95 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 3-[4-[2-[2-chloro-4-(trifluoromethoxy)phenyl]-2-cyclobutyl-1-imidazo[1,2-a]pyridin-6-ylethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(=C(c2ccc(OC(F)(F)F)cc2Cl)C2CCC2)c2ccc3nccn3c2)cc1 |
| InChI | InChI=1S/C29H22ClF3N2O3/c30-24-16-22(38-29(31,32)33)10-11-23(24)28(19-2-1-3-19)27(21-9-12-25-34-14-15-35(25)17-21)20-7-4-18(5-8-20)6-13-26(36)37/h4-17,19H,1-3H2,(H,36,37) |
| InChIKey | LOHROBAZQIOXKZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.95 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|