C28H21ClFNO2S — CID 174699273
[2-[(E)-1-(1,3-benzothiazol-5-yl)-2-(2-chloro-4-fluorophenyl)-2-cyclobutylethenyl]phenyl] prop-2-enoate (PubChem CID 174699273) has the molecular formula C28H21ClFNO2S and a molecular weight of 490.00 g/mol. Its IUPAC name is [2-[(E)-1-(1,3-benzothiazol-5-yl)-2-(2-chloro-4-fluorophenyl)-2-cyclobutylethenyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-1-(1,3-benzothiazol-5-yl)-2-(2-chloro-4-fluorophenyl)-2-cyclobutylethenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174699273 |
| Molecular Formula | C28H21ClFNO2S |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | [2-[(E)-1-(1,3-benzothiazol-5-yl)-2-(2-chloro-4-fluorophenyl)-2-cyclobutylethenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(/c1ccc(F)cc1Cl)C1CCC1)c1ccc2scnc2c1 |
| InChI | InChI=1S/C28H21ClFNO2S/c1-2-26(32)33-24-9-4-3-8-21(24)28(18-10-13-25-23(14-18)31-16-34-25)27(17-6-5-7-17)20-12-11-19(30)15-22(20)29/h2-4,8-17H,1,5-7H2/b28-27+ |
| InChIKey | JXDARXUWWNPNRW-BYYHNAKLSA-N |
| XLogP | 7.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|