C27H20ClF2NO2 — CID 174686991
[2-[(E)-2-(2-chloro-4-fluorophenyl)-1-(7-fluoro-1H-indol-5-yl)but-1-enyl]phenyl] prop-2-enoate (PubChem CID 174686991) has the molecular formula C27H20ClF2NO2 and a molecular weight of 463.91 g/mol. Its IUPAC name is [2-[(E)-2-(2-chloro-4-fluorophenyl)-1-(7-fluoro-1H-indol-5-yl)but-1-enyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-2-(2-chloro-4-fluorophenyl)-1-(7-fluoro-1H-indol-5-yl)but-1-enyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174686991 |
| Molecular Formula | C27H20ClF2NO2 |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [2-[(E)-2-(2-chloro-4-fluorophenyl)-1-(7-fluoro-1H-indol-5-yl)but-1-enyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(\CC)c1ccc(F)cc1Cl)c1cc(F)c2[nH]ccc2c1 |
| InChI | InChI=1S/C27H20ClF2NO2/c1-3-19(20-10-9-18(29)15-22(20)28)26(17-13-16-11-12-31-27(16)23(30)14-17)21-7-5-6-8-24(21)33-25(32)4-2/h4-15,31H,2-3H2,1H3/b26-19+ |
| InChIKey | KKVNAXMYUWGBJK-LGUFXXKBSA-N |
| XLogP | 7.56 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|