C28H22N2O2S — CID 174686977
[2-[(E)-2-(1-benzothiophen-5-yl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate (PubChem CID 174686977) has the molecular formula C28H22N2O2S and a molecular weight of 450.56 g/mol. Its IUPAC name is [2-[(E)-2-(1-benzothiophen-5-yl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-2-(1-benzothiophen-5-yl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174686977 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [2-[(E)-2-(1-benzothiophen-5-yl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(\CC)c1ccc2sccc2c1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C28H22N2O2S/c1-3-22(18-10-12-26-19(15-18)13-14-33-26)28(20-9-11-24-21(16-20)17-29-30-24)23-7-5-6-8-25(23)32-27(31)4-2/h4-17H,2-3H2,1H3,(H,29,30)/b28-22+ |
| InChIKey | LDUYTOGEFCFUNV-XAYXJRQQSA-N |
| XLogP | 7.24 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|