C25H21N3O2 — CID 174686822
[2-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenyl] prop-2-enoate (PubChem CID 174686822) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174686822 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [2-[(E)-2-phenyl-1-(1H-pyrazolo[4,5-b]pyridin-5-yl)but-1-enyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(/CC)c1ccccc1)c1ccc2[nH]ncc2n1 |
| InChI | InChI=1S/C25H21N3O2/c1-3-18(17-10-6-5-7-11-17)25(21-15-14-20-22(27-21)16-26-28-20)19-12-8-9-13-23(19)30-24(29)4-2/h4-16H,2-3H2,1H3,(H,26,28)/b25-18+ |
| InChIKey | OUXIYPSNVMWOFD-XIEYBQDHSA-N |
| XLogP | 5.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|