C26H20F2N2O2 — CID 174699255
[2-[(E)-4-fluoro-1-(4-fluoro-1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate (PubChem CID 174699255) has the molecular formula C26H20F2N2O2 and a molecular weight of 430.45 g/mol. Its IUPAC name is [2-[(E)-4-fluoro-1-(4-fluoro-1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-4-fluoro-1-(4-fluoro-1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174699255 |
| Molecular Formula | C26H20F2N2O2 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [2-[(E)-4-fluoro-1-(4-fluoro-1H-indazol-5-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(/CCF)c1ccccc1)c1ccc2[nH]ncc2c1F |
| InChI | InChI=1S/C26H20F2N2O2/c1-2-24(31)32-23-11-7-6-10-19(23)25(18(14-15-27)17-8-4-3-5-9-17)20-12-13-22-21(26(20)28)16-29-30-22/h2-13,16H,1,14-15H2,(H,29,30)/b25-18+ |
| InChIKey | RCGQVESHMBGRIX-XIEYBQDHSA-N |
| XLogP | 6.11 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|