C27H23NO4 — CID 174686826
[2-[(E)-1-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate (PubChem CID 174686826) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is [2-[(E)-1-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-1-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174686826 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [2-[(E)-1-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)-2-phenylbut-1-enyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1/C(=C(\CC)c1ccccc1)c1ccc2c(c1)COC(=O)N2 |
| InChI | InChI=1S/C27H23NO4/c1-3-21(18-10-6-5-7-11-18)26(22-12-8-9-13-24(22)32-25(29)4-2)19-14-15-23-20(16-19)17-31-27(30)28-23/h4-16H,2-3,17H2,1H3,(H,28,30)/b26-21+ |
| InChIKey | PYFJSCGQEWFYJG-YYADALCUSA-N |
| XLogP | 6.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|