C30H29ClFNO3 — CID 126657734
(E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(3-morpholin-4-ylcyclopenta-2,4-dien-1-yl)ethenyl]phenyl]prop-2-enoic acid (PubChem CID 126657734) has the molecular formula C30H29ClFNO3 and a molecular weight of 506.02 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(3-morpholin-4-ylcyclopenta-2,4-dien-1-yl)ethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(3-morpholin-4-ylcyclopenta-2,4-dien-1-yl)ethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126657734 |
| Molecular Formula | C30H29ClFNO3 |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | (E)-3-[4-[(Z)-2-(2-chloro-4-fluorophenyl)-2-cyclobutyl-1-(3-morpholin-4-ylcyclopenta-2,4-dien-1-yl)ethenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(/C(=C(\c2ccc(F)cc2Cl)C2CCC2)C2C=CC(N3CCOCC3)=C2)cc1 |
| InChI | InChI=1S/C30H29ClFNO3/c31-27-19-24(32)10-12-26(27)30(21-2-1-3-21)29(22-7-4-20(5-8-22)6-13-28(34)35)23-9-11-25(18-23)33-14-16-36-17-15-33/h4-13,18-19,21,23H,1-3,14-17H2,(H,34,35)/b13-6+,30-29+ |
| InChIKey | FKFPXYLTRKMLIP-JJAKXVQJSA-N |
| XLogP | 6.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|