C33H28ClN3O2 — CID 140753675
ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1H-pyrazol-4-yl)phenyl]ethenyl]phenyl]prop-2-enoate (PubChem CID 140753675) has the molecular formula C33H28ClN3O2 and a molecular weight of 534.06 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1H-pyrazol-4-yl)phenyl]ethenyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1H-pyrazol-4-yl)phenyl]ethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140753675 |
| Molecular Formula | C33H28ClN3O2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-2-cyclobutyl-1-[4-(1H-pyrazol-4-yl)phenyl]ethenyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(\c2ccc(C#N)cc2Cl)C2CCC2)c2ccc(-c3cn[nH]c3)cc2)cc1 |
| InChI | InChI=1S/C33H28ClN3O2/c1-2-39-31(38)17-9-22-6-10-26(11-7-22)32(27-14-12-24(13-15-27)28-20-36-37-21-28)33(25-4-3-5-25)29-16-8-23(19-35)18-30(29)34/h6-18,20-21,25H,2-5H2,1H3,(H,36,37)/b17-9+,33-32+ |
| InChIKey | FYBCUUQYRMMPPL-CJKRBVGJSA-N |
| XLogP | 7.94 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|