C33H36N2O2 — CID 140753678
ethyl (E)-3-[4-[(E)-2-cyclobutyl-2-phenyl-1-(4-piperazin-1-ylphenyl)ethenyl]phenyl]prop-2-enoate (PubChem CID 140753678) has the molecular formula C33H36N2O2 and a molecular weight of 492.66 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-2-cyclobutyl-2-phenyl-1-(4-piperazin-1-ylphenyl)ethenyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-2-cyclobutyl-2-phenyl-1-(4-piperazin-1-ylphenyl)ethenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140753678 |
| Molecular Formula | C33H36N2O2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-2-cyclobutyl-2-phenyl-1-(4-piperazin-1-ylphenyl)ethenyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(\c2ccccc2)C2CCC2)c2ccc(N3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C33H36N2O2/c1-2-37-31(36)20-13-25-11-14-28(15-12-25)33(32(27-9-6-10-27)26-7-4-3-5-8-26)29-16-18-30(19-17-29)35-23-21-34-22-24-35/h3-5,7-8,11-20,27,34H,2,6,9-10,21-24H2,1H3/b20-13+,33-32- |
| InChIKey | MMPNDNVKIWZGCA-QFLJEEOPSA-N |
| XLogP | 6.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|