C31H26ClN3O2 — CID 144718274
(E)-3-[4-[(E)-1-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-(2-chloro-4-cyanophenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid (PubChem CID 144718274) has the molecular formula C31H26ClN3O2 and a molecular weight of 508.02 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-(2-chloro-4-cyanophenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-(2-chloro-4-cyanophenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144718274 |
| Molecular Formula | C31H26ClN3O2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | (E)-3-[4-[(E)-1-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-(2-chloro-4-cyanophenyl)-2-cyclobutylethenyl]phenyl]prop-2-enoic acid |
| SMILES | [H]/N=C/C(=C\N)c1ccc(/C(=C(/c2ccc(C#N)cc2Cl)C2CCC2)c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H26ClN3O2/c32-28-16-21(17-33)6-14-27(28)31(23-2-1-3-23)30(24-8-4-20(5-9-24)7-15-29(36)37)25-12-10-22(11-13-25)26(18-34)19-35/h4-16,18-19,23,34H,1-3,35H2,(H,36,37)/b15-7+,26-19+,31-30+,34-18+ |
| InChIKey | AHKSXUNPLZKNIP-LEYFKTCASA-N |
| XLogP | 7.02 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|