C34H31ClFN3O2 — CID 123488589
3-[4-[2-(2-chloro-4-methoxyphenyl)-2-cyclobutyl-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]ethenyl]phenyl]prop-2-enenitrile (PubChem CID 123488589) has the molecular formula C34H31ClFN3O2 and a molecular weight of 568.09 g/mol. Its IUPAC name is 3-[4-[2-(2-chloro-4-methoxyphenyl)-2-cyclobutyl-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]ethenyl]phenyl]prop-2-enenitrile.
| Compound Name | 3-[4-[2-(2-chloro-4-methoxyphenyl)-2-cyclobutyl-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]ethenyl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 123488589 |
| Molecular Formula | C34H31ClFN3O2 |
| Molecular Weight | 568.09 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 3-[4-[2-(2-chloro-4-methoxyphenyl)-2-cyclobutyl-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]ethenyl]phenyl]prop-2-enenitrile |
| SMILES | COc1ccc(C(=C(c2ccc(C=CC#N)cc2)c2ccc3c(c2)c(F)nn3C2CCCCO2)C2CCC2)c(Cl)c1 |
| InChI | InChI=1S/C34H31ClFN3O2/c1-40-26-15-16-27(29(35)21-26)33(23-7-4-8-23)32(24-12-10-22(11-13-24)6-5-18-37)25-14-17-30-28(20-25)34(36)38-39(30)31-9-2-3-19-41-31/h5-6,10-17,20-21,23,31H,2-4,7-9,19H2,1H3 |
| InChIKey | BECCNIZWEJHCBP-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.09 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|