C29H24ClF2NO2 — CID 137445460
ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(6-fluoro-1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate (PubChem CID 137445460) has the molecular formula C29H24ClF2NO2 and a molecular weight of 491.97 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(6-fluoro-1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(6-fluoro-1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 137445460 |
| Molecular Formula | C29H24ClF2NO2 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | ethyl (E)-3-[4-[(E)-2-(2-chloro-4-fluorophenyl)-1-(6-fluoro-1H-indol-2-yl)but-1-enyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(/C(=C(/CC)c2ccc(F)cc2Cl)c2cc3ccc(F)cc3[nH]2)cc1 |
| InChI | InChI=1S/C29H24ClF2NO2/c1-3-23(24-13-12-21(31)16-25(24)30)29(27-15-20-10-11-22(32)17-26(20)33-27)19-8-5-18(6-9-19)7-14-28(34)35-4-2/h5-17,33H,3-4H2,1-2H3/b14-7+,29-23+ |
| InChIKey | RZQZVGFWXYENBZ-FJZKQSJVSA-N |
| XLogP | 8.04 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|