C26H21Cl2NOS — CID 163518206
(E)-4-[4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]but-3-en-2-one (PubChem CID 163518206) has the molecular formula C26H21Cl2NOS and a molecular weight of 466.43 g/mol. Its IUPAC name is (E)-4-[4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 163518206 |
| Molecular Formula | C26H21Cl2NOS |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (E)-4-[4-[(E)-2-(2,5-dichlorothiophen-3-yl)-1-(1H-indol-2-yl)but-1-enyl]phenyl]but-3-en-2-one |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(C)=O)cc1)c1cc2ccccc2[nH]1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C26H21Cl2NOS/c1-3-20(21-15-24(27)31-26(21)28)25(23-14-19-6-4-5-7-22(19)29-23)18-12-10-17(11-13-18)9-8-16(2)30/h4-15,29H,3H2,1-2H3/b9-8+,25-20+ |
| InChIKey | DIOOVXCBXOZTDV-HNYWWJJZSA-N |
| XLogP | 8.51 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|