C25H18Cl3NO2S — CID 138534536
(E)-3-[4-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(2,5-dichlorothiophen-3-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 138534536) has the molecular formula C25H18Cl3NO2S and a molecular weight of 502.85 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(2,5-dichlorothiophen-3-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(2,5-dichlorothiophen-3-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138534536 |
| Molecular Formula | C25H18Cl3NO2S |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | (E)-3-[4-[(E)-1-(3-chloro-1H-indol-2-yl)-2-(2,5-dichlorothiophen-3-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1[nH]c2ccccc2c1Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C25H18Cl3NO2S/c1-2-16(18-13-20(26)32-25(18)28)22(15-10-7-14(8-11-15)9-12-21(30)31)24-23(27)17-5-3-4-6-19(17)29-24/h3-13,29H,2H2,1H3,(H,30,31)/b12-9+,22-16+ |
| InChIKey | PCNMURVECJDOJU-YXNARQPMSA-N |
| XLogP | 8.66 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|