C27H24ClFN2O2 — CID 145017651
methyl (E)-3-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-(2-chloro-4-fluorophenyl)but-1-enyl]phenyl]prop-2-enoate (PubChem CID 145017651) has the molecular formula C27H24ClFN2O2 and a molecular weight of 462.95 g/mol. Its IUPAC name is methyl (E)-3-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-(2-chloro-4-fluorophenyl)but-1-enyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-(2-chloro-4-fluorophenyl)but-1-enyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 145017651 |
| Molecular Formula | C27H24ClFN2O2 |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | methyl (E)-3-[4-[(E)-1-(4-amino-3-methanimidoylphenyl)-2-(2-chloro-4-fluorophenyl)but-1-enyl]phenyl]prop-2-enoate |
| SMILES | [H]/N=C/c1cc(/C(=C(\CC)c2ccc(F)cc2Cl)c2ccc(/C=C/C(=O)OC)cc2)ccc1N |
| InChI | InChI=1S/C27H24ClFN2O2/c1-3-22(23-11-10-21(29)15-24(23)28)27(19-9-12-25(31)20(14-19)16-30)18-7-4-17(5-8-18)6-13-26(32)33-2/h4-16,30H,3,31H2,1-2H3/b13-6+,27-22+,30-16+ |
| InChIKey | RFNLSVONPASUAN-LSPCXDMISA-N |
| XLogP | 6.61 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|