C30H27ClFNO2 — CID 163786202
6-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]-2-pyridinyl]oxy]hex-1-en-3-one (PubChem CID 163786202) has the molecular formula C30H27ClFNO2 and a molecular weight of 488.00 g/mol. Its IUPAC name is 6-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]-2-pyridinyl]oxy]hex-1-en-3-one.
| Compound Name | 6-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]-2-pyridinyl]oxy]hex-1-en-3-one |
|---|---|
| PubChem CID | 163786202 |
| Molecular Formula | C30H27ClFNO2 |
| Molecular Weight | 488.00 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 6-[[5-[(Z)-2-(2-chloro-4-fluorophenyl)-1-(1H-inden-2-yl)but-1-enyl]-2-pyridinyl]oxy]hex-1-en-3-one |
| SMILES | C=CC(=O)CCCOc1ccc(/C(C2=Cc3ccccc3C2)=C(/CC)c2ccc(F)cc2Cl)cn1 |
| InChI | InChI=1S/C30H27ClFNO2/c1-3-25(34)10-7-15-35-29-14-11-22(19-33-29)30(23-16-20-8-5-6-9-21(20)17-23)26(4-2)27-13-12-24(32)18-28(27)31/h3,5-6,8-9,11-14,16,18-19H,1,4,7,10,15,17H2,2H3/b30-26+ |
| InChIKey | ZWNNVCGDWJLGRV-URGPHPNLSA-N |
| XLogP | 7.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.00 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|